C19H18N2O3S — CID 7766629
[(1S)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-phenylprop-2-enoate (PubChem CID 7766629) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is [(1S)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7766629 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [(1S)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-phenylprop-2-enoate |
| SMILES | Cc1sc2nc([C@H](C)OC(=O)/C=C/c3ccccc3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C19H18N2O3S/c1-11-13(3)25-19-16(11)18(23)20-17(21-19)12(2)24-15(22)10-9-14-7-5-4-6-8-14/h4-10,12H,1-3H3,(H,20,21,23)/b10-9+/t12-/m0/s1 |
| InChIKey | FGHBKNJPLMMMSE-VMPCVLLUSA-N |
| XLogP | 3.92 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|