C21H16N2O3S2 — CID 7766623
[(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-phenylprop-2-enoate (PubChem CID 7766623) has the molecular formula C21H16N2O3S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7766623 |
| Molecular Formula | C21H16N2O3S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-phenylprop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccccc1)c1nc2scc(-c3cccs3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C21H16N2O3S2/c1-13(26-17(24)10-9-14-6-3-2-4-7-14)19-22-20(25)18-15(12-28-21(18)23-19)16-8-5-11-27-16/h2-13H,1H3,(H,22,23,25)/b10-9+/t13-/m1/s1 |
| InChIKey | LPOVYHSTDMCVHD-WTNCMQEWSA-N |
| XLogP | 5.03 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|