C16H14N2O3S2 — CID 7932754
[(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-but-2-enoate (PubChem CID 7932754) has the molecular formula C16H14N2O3S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-but-2-enoate.
| Compound Name | [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7932754 |
| Molecular Formula | C16H14N2O3S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | [(1R)-1-(4-oxo-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@H](C)c1nc2scc(-c3cccs3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H14N2O3S2/c1-3-5-12(19)21-9(2)14-17-15(20)13-10(8-23-16(13)18-14)11-6-4-7-22-11/h3-9H,1-2H3,(H,17,18,20)/b5-3+/t9-/m1/s1 |
| InChIKey | OODAWWURCYDATC-HYYFJVDXSA-N |
| XLogP | 3.89 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|