C13H8BrClN2OS — CID 29078980
5-(2-bromophenyl)-2-(chloromethyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 29078980) has the molecular formula C13H8BrClN2OS and a molecular weight of 355.64 g/mol. Its IUPAC name is 5-(2-bromophenyl)-2-(chloromethyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(2-bromophenyl)-2-(chloromethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29078980 |
| Molecular Formula | C13H8BrClN2OS |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 353.92 |
| IUPAC Name | 5-(2-bromophenyl)-2-(chloromethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCl)nc2scc(-c3ccccc3Br)c12 |
| InChI | InChI=1S/C13H8BrClN2OS/c14-9-4-2-1-3-7(9)8-6-19-13-11(8)12(18)16-10(5-15)17-13/h1-4,6H,5H2,(H,16,17,18) |
| InChIKey | ADVXRQKRNAJQLA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|