C12H9BrN2OS2 — CID 82065049
2-(2-bromoethyl)-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 82065049) has the molecular formula C12H9BrN2OS2 and a molecular weight of 341.26 g/mol. Its IUPAC name is 2-(2-bromoethyl)-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-bromoethyl)-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82065049 |
| Molecular Formula | C12H9BrN2OS2 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | 2-(2-bromoethyl)-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCBr)nc2scc(-c3cccs3)c12 |
| InChI | InChI=1S/C12H9BrN2OS2/c13-4-3-9-14-11(16)10-7(6-18-12(10)15-9)8-2-1-5-17-8/h1-2,5-6H,3-4H2,(H,14,15,16) |
| InChIKey | YRNYDWPRARCTAG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|