C13H11BrN2OS2 — CID 82065026
2-(2-bromoethyl)-6-methyl-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 82065026) has the molecular formula C13H11BrN2OS2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 2-(2-bromoethyl)-6-methyl-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-bromoethyl)-6-methyl-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82065026 |
| Molecular Formula | C13H11BrN2OS2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-(2-bromoethyl)-6-methyl-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CCBr)[nH]c(=O)c2c1-c1cccs1 |
| InChI | InChI=1S/C13H11BrN2OS2/c1-7-10(8-3-2-6-18-8)11-12(17)15-9(4-5-14)16-13(11)19-7/h2-3,6H,4-5H2,1H3,(H,15,16,17) |
| InChIKey | XJIYJHVYWRGUAC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|