C10H10BrN3O2S — CID 93213436
2-(2-bromoethyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 93213436) has the molecular formula C10H10BrN3O2S and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-(2-bromoethyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-(2-bromoethyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 93213436 |
| Molecular Formula | C10H10BrN3O2S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 2-(2-bromoethyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(N)=O)sc2nc(CCBr)[nH]c(=O)c12 |
| InChI | InChI=1S/C10H10BrN3O2S/c1-4-6-9(16)13-5(2-3-11)14-10(6)17-7(4)8(12)15/h2-3H2,1H3,(H2,12,15)(H,13,14,16) |
| InChIKey | HQQASPKOPMLHJZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|