C18H16N3OS2+ — CID 8857409
2-[(4-ethylpyridin-1-ium-1-yl)methyl]-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 8857409) has the molecular formula C18H16N3OS2+ and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-[(4-ethylpyridin-1-ium-1-yl)methyl]-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(4-ethylpyridin-1-ium-1-yl)methyl]-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 8857409 |
| Molecular Formula | C18H16N3OS2+ |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-[(4-ethylpyridin-1-ium-1-yl)methyl]-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc[n+](Cc2nc3scc(-c4cccs4)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H15N3OS2/c1-2-12-5-7-21(8-6-12)10-15-19-17(22)16-13(11-24-18(16)20-15)14-4-3-9-23-14/h3-9,11H,2,10H2,1H3/p+1 |
| InChIKey | OKCWWXLXFKEEDK-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|