C23H23ClN3OS+ — CID 31622793
5-(4-chlorophenyl)-2-[(4-pentan-3-ylpyridin-1-ium-1-yl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 31622793) has the molecular formula C23H23ClN3OS+ and a molecular weight of 424.98 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[(4-pentan-3-ylpyridin-1-ium-1-yl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-chlorophenyl)-2-[(4-pentan-3-ylpyridin-1-ium-1-yl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 31622793 |
| Molecular Formula | C23H23ClN3OS+ |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[(4-pentan-3-ylpyridin-1-ium-1-yl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCC(CC)c1cc[n+](Cc2nc3scc(-c4ccc(Cl)cc4)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C23H22ClN3OS/c1-3-15(4-2)16-9-11-27(12-10-16)13-20-25-22(28)21-19(14-29-23(21)26-20)17-5-7-18(24)8-6-17/h5-12,14-15H,3-4,13H2,1-2H3/p+1 |
| InChIKey | CHBFZILXKXCSQA-UHFFFAOYSA-O |
| XLogP | 5.54 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|