C19H14Cl2N4O2S — CID 18229610
1-[[5-(4-chlorophenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]methyl]pyridin-1-ium-3-carboxamide chloride (PubChem CID 18229610) has the molecular formula C19H14Cl2N4O2S and a molecular weight of 433.32 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]methyl]pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-[[5-(4-chlorophenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]methyl]pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 18229610 |
| Molecular Formula | C19H14Cl2N4O2S |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]methyl]pyridin-1-ium-3-carboxamide chloride |
| SMILES | NC(=O)c1ccc[n+](Cc2nc3scc(-c4ccc(Cl)cc4)c3c(=O)[nH]2)c1.[Cl-] |
| InChI | InChI=1S/C19H13ClN4O2S.ClH/c20-13-5-3-11(4-6-13)14-10-27-19-16(14)18(26)22-15(23-19)9-24-7-1-2-12(8-24)17(21)25;/h1-8,10H,9H2,(H2-,21,22,23,25,26);1H |
| InChIKey | GMGMIVMIOKAQPB-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 92.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|