C16H15ClN2OS2 — CID 7309625
2-butylsulfanyl-5-(4-chlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 7309625) has the molecular formula C16H15ClN2OS2 and a molecular weight of 350.90 g/mol. Its IUPAC name is 2-butylsulfanyl-5-(4-chlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-butylsulfanyl-5-(4-chlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7309625 |
| Molecular Formula | C16H15ClN2OS2 |
| Molecular Weight | 350.90 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-butylsulfanyl-5-(4-chlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCCSc1nc2scc(-c3ccc(Cl)cc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H15ClN2OS2/c1-2-3-8-21-16-18-14(20)13-12(9-22-15(13)19-16)10-4-6-11(17)7-5-10/h4-7,9H,2-3,8H2,1H3,(H,18,19,20) |
| InChIKey | VCRKKUXRSSYDJR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|