C19H19FN4O3S2 — CID 24500776
N-(butylcarbamoyl)-2-[[5-(4-fluorophenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 24500776) has the molecular formula C19H19FN4O3S2 and a molecular weight of 434.52 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[[5-(4-fluorophenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[[5-(4-fluorophenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 24500776 |
| Molecular Formula | C19H19FN4O3S2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-(butylcarbamoyl)-2-[[5-(4-fluorophenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | CCCCNC(=O)NC(=O)CSc1nc2scc(-c3ccc(F)cc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H19FN4O3S2/c1-2-3-8-21-18(27)22-14(25)10-29-19-23-16(26)15-13(9-28-17(15)24-19)11-4-6-12(20)7-5-11/h4-7,9H,2-3,8,10H2,1H3,(H,23,24,26)(H2,21,22,25,27) |
| InChIKey | IWFGCYXULZSBPC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|