C16H10ClN3OS3 — CID 51124555
5-(2-chlorophenyl)-2-(1,3-thiazol-2-ylsulfanylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 51124555) has the molecular formula C16H10ClN3OS3 and a molecular weight of 391.93 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-(1,3-thiazol-2-ylsulfanylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(2-chlorophenyl)-2-(1,3-thiazol-2-ylsulfanylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 51124555 |
| Molecular Formula | C16H10ClN3OS3 |
| Molecular Weight | 391.93 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 5-(2-chlorophenyl)-2-(1,3-thiazol-2-ylsulfanylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CSc2nccs2)nc2scc(-c3ccccc3Cl)c12 |
| InChI | InChI=1S/C16H10ClN3OS3/c17-11-4-2-1-3-9(11)10-7-23-15-13(10)14(21)19-12(20-15)8-24-16-18-5-6-22-16/h1-7H,8H2,(H,19,20,21) |
| InChIKey | WQSKHJCSAJUALO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.93 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|