C21H17ClN6OS2 — CID 55869073
5-(2-chlorophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 55869073) has the molecular formula C21H17ClN6OS2 and a molecular weight of 469.00 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(2-chlorophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55869073 |
| Molecular Formula | C21H17ClN6OS2 |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 5-(2-chlorophenyl)-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2nc(SCc3nc4scc(-c5ccccc5Cl)c4c(=O)[nH]3)nn2c(C)c1C |
| InChI | InChI=1S/C21H17ClN6OS2/c1-10-11(2)23-20-26-21(27-28(20)12(10)3)31-9-16-24-18(29)17-14(8-30-19(17)25-16)13-6-4-5-7-15(13)22/h4-8H,9H2,1-3H3,(H,24,25,29) |
| InChIKey | KBTMTWUFPHHYKG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |