C17H11ClN2OS — CID 82064982
2-(chloromethyl)-5-naphthalen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 82064982) has the molecular formula C17H11ClN2OS and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-(chloromethyl)-5-naphthalen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(chloromethyl)-5-naphthalen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82064982 |
| Molecular Formula | C17H11ClN2OS |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-(chloromethyl)-5-naphthalen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCl)nc2scc(-c3ccc4ccccc4c3)c12 |
| InChI | InChI=1S/C17H11ClN2OS/c18-8-14-19-16(21)15-13(9-22-17(15)20-14)12-6-5-10-3-1-2-4-11(10)7-12/h1-7,9H,8H2,(H,19,20,21) |
| InChIKey | YBJSXWDWNMSNAA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|