C17H18N2OS — CID 28868432
5-(3,4-dimethylphenyl)-2-propyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 28868432) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-2-propyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3,4-dimethylphenyl)-2-propyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28868432 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-2-propyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCc1nc2scc(-c3ccc(C)c(C)c3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H18N2OS/c1-4-5-14-18-16(20)15-13(9-21-17(15)19-14)12-7-6-10(2)11(3)8-12/h6-9H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | POSLWABIMPPRGL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |