C14H13N3OS — CID 82055590
2-amino-5-(3,4-dimethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 82055590) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-amino-5-(3,4-dimethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-(3,4-dimethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82055590 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-amino-5-(3,4-dimethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2csc3nc(N)[nH]c(=O)c23)cc1C |
| InChI | InChI=1S/C14H13N3OS/c1-7-3-4-9(5-8(7)2)10-6-19-13-11(10)12(18)16-14(15)17-13/h3-6H,1-2H3,(H3,15,16,17,18) |
| InChIKey | UECOOFUJRZDOMW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |