C12H8BrClN2O2S — CID 104653876
5-(5-bromofuran-2-yl)-2-(1-chloroethyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 104653876) has the molecular formula C12H8BrClN2O2S and a molecular weight of 359.63 g/mol. Its IUPAC name is 5-(5-bromofuran-2-yl)-2-(1-chloroethyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(5-bromofuran-2-yl)-2-(1-chloroethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 104653876 |
| Molecular Formula | C12H8BrClN2O2S |
| Molecular Weight | 359.63 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 5-(5-bromofuran-2-yl)-2-(1-chloroethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC(Cl)c1nc2scc(-c3ccc(Br)o3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H8BrClN2O2S/c1-5(14)10-15-11(17)9-6(4-19-12(9)16-10)7-2-3-8(13)18-7/h2-5H,1H3,(H,15,16,17) |
| InChIKey | BPLDWHVDQUQCOC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|