C13H10BrClN2O2S — CID 104653877
5-(5-bromofuran-2-yl)-2-(1-chloropropyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 104653877) has the molecular formula C13H10BrClN2O2S and a molecular weight of 373.66 g/mol. Its IUPAC name is 5-(5-bromofuran-2-yl)-2-(1-chloropropyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(5-bromofuran-2-yl)-2-(1-chloropropyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 104653877 |
| Molecular Formula | C13H10BrClN2O2S |
| Molecular Weight | 373.66 g/mol |
| Exact Mass | 371.93 |
| IUPAC Name | 5-(5-bromofuran-2-yl)-2-(1-chloropropyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCC(Cl)c1nc2scc(-c3ccc(Br)o3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C13H10BrClN2O2S/c1-2-7(15)11-16-12(18)10-6(5-20-13(10)17-11)8-3-4-9(14)19-8/h3-5,7H,2H2,1H3,(H,16,17,18) |
| InChIKey | RSTIPOLFCMWMHM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|