C7H7N3OS — CID 132588390
2,5-dimethyl-6H-[1,3]thiazolo[5,4-d]pyrimidin-7-one (PubChem CID 132588390) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 2,5-dimethyl-6H-[1,3]thiazolo[5,4-d]pyrimidin-7-one.
| Compound Name | 2,5-dimethyl-6H-[1,3]thiazolo[5,4-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 132588390 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 2,5-dimethyl-6H-[1,3]thiazolo[5,4-d]pyrimidin-7-one |
| SMILES | Cc1nc2sc(C)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N3OS/c1-3-8-6(11)5-7(9-3)12-4(2)10-5/h1-2H3,(H,8,9,11) |
| InChIKey | RDCHNLXVVKTAJQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |