C9H9N3O — CID 149062893
2,7-dimethyl-3H-pyrido[3,2-d]pyrimidin-4-one (PubChem CID 149062893) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 2,7-dimethyl-3H-pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 2,7-dimethyl-3H-pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 149062893 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 2,7-dimethyl-3H-pyrido[3,2-d]pyrimidin-4-one |
| SMILES | Cc1cnc2c(=O)[nH]c(C)nc2c1 |
| InChI | InChI=1S/C9H9N3O/c1-5-3-7-8(10-4-5)9(13)12-6(2)11-7/h3-4H,1-2H3,(H,11,12,13) |
| InChIKey | QMEUQILAYYJGQJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |