C8H6N2O3 — CID 123759693
7-methyl-1H-pyrido[3,2-d][1,3]oxazine-2,4-dione (PubChem CID 123759693) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is 7-methyl-1H-pyrido[3,2-d][1,3]oxazine-2,4-dione.
| Compound Name | 7-methyl-1H-pyrido[3,2-d][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 123759693 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 7-methyl-1H-pyrido[3,2-d][1,3]oxazine-2,4-dione |
| SMILES | Cc1cnc2c(=O)oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C8H6N2O3/c1-4-2-5-6(9-3-4)7(11)13-8(12)10-5/h2-3H,1H3,(H,10,12) |
| InChIKey | UYUOQFBQGGDZOW-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |