About CID 177158828
CID 177158828 (PubChem CID 177158828) has the molecular formula C10H9N2O
and a molecular weight of 173.19 g/mol.
Molecular Properties
| Compound Name | CID 177158828 |
| PubChem CID | 177158828 |
| Molecular Formula | C10H9N2O |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | — |
| SMILES | [CH2]c1ccc2c(=O)[nH]c(C)nc2c1 |
| InChI | InChI=1S/C10H9N2O/c1-6-3-4-8-9(5-6)11-7(2)12-10(8)13/h3-5H,1H2,2H3,(H,11,12,13) |
| InChIKey | SWJQWSSIJHZBEH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 177158828 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177158828?
The IUPAC name of CID 177158828 (CID 177158828) is not available.
What is the SMILES notation for CID 177158828?
The canonical SMILES for CID 177158828 is [CH2]c1ccc2c(=O)[nH]c(C)nc2c1.
What is the InChIKey of CID 177158828?
The InChIKey is SWJQWSSIJHZBEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N2O/c1-6-3-4-8-9(5-6)11-7(2)12-10(8)13/h3-5H,1H2,2H3,(H,11,12,13).
What are the key properties of CID 177158828?
CID 177158828 has a molecular weight of 173.19 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177158828 is sourced from PubChem (CID 177158828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).