C10H9N2O — CID 177158828
CID 177158828 (PubChem CID 177158828) has the molecular formula C10H9N2O and a molecular weight of 173.19 g/mol.
| Compound Name | CID 177158828 |
|---|---|
| PubChem CID | 177158828 |
| Molecular Formula | C10H9N2O |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | — |
| SMILES | [CH2]c1ccc2c(=O)[nH]c(C)nc2c1 |
| InChI | InChI=1S/C10H9N2O/c1-6-3-4-8-9(5-6)11-7(2)12-10(8)13/h3-5H,1H2,2H3,(H,11,12,13) |
| InChIKey | SWJQWSSIJHZBEH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |