C13H12N4O3 — CID 156537248
2,6,9-trimethyl-3H-pyrazino[2,3-g]quinazoline-4,7,8-trione (PubChem CID 156537248) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2,6,9-trimethyl-3H-pyrazino[2,3-g]quinazoline-4,7,8-trione.
| Compound Name | 2,6,9-trimethyl-3H-pyrazino[2,3-g]quinazoline-4,7,8-trione |
|---|---|
| PubChem CID | 156537248 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2,6,9-trimethyl-3H-pyrazino[2,3-g]quinazoline-4,7,8-trione |
| SMILES | Cc1nc2cc3c(cc2c(=O)[nH]1)n(C)c(=O)c(=O)n3C |
| InChI | InChI=1S/C13H12N4O3/c1-6-14-8-5-10-9(4-7(8)11(18)15-6)16(2)12(19)13(20)17(10)3/h4-5H,1-3H3,(H,14,15,18) |
| InChIKey | KIKARWJTRSQWJG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|