C7H7N3O2S — CID 163626605
2,4-dimethyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione (PubChem CID 163626605) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is 2,4-dimethyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione.
| Compound Name | 2,4-dimethyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 163626605 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2,4-dimethyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
| SMILES | Cc1nc2c(=O)[nH]c(=O)n(C)c2s1 |
| InChI | InChI=1S/C7H7N3O2S/c1-3-8-4-5(11)9-7(12)10(2)6(4)13-3/h1-2H3,(H,9,11,12) |
| InChIKey | HSOMPRUIGRCJSM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |