C6H4N8O2 — CID 564848
10-methyl-2,3,4,5,6,8,10,12-octazatricyclo[7.4.0.03,7]trideca-1,4,6,8-tetraene-11,13-dione (PubChem CID 564848) has the molecular formula C6H4N8O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is 10-methyl-2,3,4,5,6,8,10,12-octazatricyclo[7.4.0.03,7]trideca-1,4,6,8-tetraene-11,13-dione.
| Compound Name | 10-methyl-2,3,4,5,6,8,10,12-octazatricyclo[7.4.0.03,7]trideca-1,4,6,8-tetraene-11,13-dione |
|---|---|
| PubChem CID | 564848 |
| Molecular Formula | C6H4N8O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 10-methyl-2,3,4,5,6,8,10,12-octazatricyclo[7.4.0.03,7]trideca-1,4,6,8-tetraene-11,13-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2nn3nnnc3nc21 |
| InChI | InChI=1S/C6H4N8O2/c1-13-3-2(4(15)8-6(13)16)10-14-5(7-3)9-11-12-14/h1H3,(H,8,15,16) |
| InChIKey | PAVGERZXHXQHRZ-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |