C12H14N6O2 — CID 115925707
3-methyl-8-(1,3,5-trimethylpyrazol-4-yl)-7H-purine-2,6-dione (PubChem CID 115925707) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-methyl-8-(1,3,5-trimethylpyrazol-4-yl)-7H-purine-2,6-dione.
| Compound Name | 3-methyl-8-(1,3,5-trimethylpyrazol-4-yl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115925707 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-methyl-8-(1,3,5-trimethylpyrazol-4-yl)-7H-purine-2,6-dione |
| SMILES | Cc1nn(C)c(C)c1-c1nc2c([nH]1)c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C12H14N6O2/c1-5-7(6(2)18(4)16-5)9-13-8-10(14-9)17(3)12(20)15-11(8)19/h1-4H3,(H,13,14)(H,15,19,20) |
| InChIKey | JUHDZEZNJXQFHB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |