C11H14N4O4S — CID 43840163
ethyl 2-[(3-methyl-2,6-dioxo-7H-purin-8-yl)methylsulfanyl]acetate (PubChem CID 43840163) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is ethyl 2-[(3-methyl-2,6-dioxo-7H-purin-8-yl)methylsulfanyl]acetate.
| Compound Name | ethyl 2-[(3-methyl-2,6-dioxo-7H-purin-8-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 43840163 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | ethyl 2-[(3-methyl-2,6-dioxo-7H-purin-8-yl)methylsulfanyl]acetate |
| SMILES | CCOC(=O)CSCc1nc2c([nH]1)c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C11H14N4O4S/c1-3-19-7(16)5-20-4-6-12-8-9(13-6)15(2)11(18)14-10(8)17/h3-5H2,1-2H3,(H,12,13)(H,14,17,18) |
| InChIKey | JUTUCUUBLPOQGU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |