C8H7F3N4O2 — CID 112569071
3-methyl-8-(2,2,2-trifluoroethyl)-7H-purine-2,6-dione (PubChem CID 112569071) has the molecular formula C8H7F3N4O2 and a molecular weight of 248.16 g/mol. Its IUPAC name is 3-methyl-8-(2,2,2-trifluoroethyl)-7H-purine-2,6-dione.
| Compound Name | 3-methyl-8-(2,2,2-trifluoroethyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 112569071 |
| Molecular Formula | C8H7F3N4O2 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-methyl-8-(2,2,2-trifluoroethyl)-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(CC(F)(F)F)nc21 |
| InChI | InChI=1S/C8H7F3N4O2/c1-15-5-4(6(16)14-7(15)17)12-3(13-5)2-8(9,10)11/h2H2,1H3,(H,12,13)(H,14,16,17) |
| InChIKey | VBIWASQJMUGJSD-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |