C13H10F2N4O2 — CID 115925795
8-[(3,4-difluorophenyl)methyl]-3-methyl-7H-purine-2,6-dione (PubChem CID 115925795) has the molecular formula C13H10F2N4O2 and a molecular weight of 292.25 g/mol. Its IUPAC name is 8-[(3,4-difluorophenyl)methyl]-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-[(3,4-difluorophenyl)methyl]-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115925795 |
| Molecular Formula | C13H10F2N4O2 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 8-[(3,4-difluorophenyl)methyl]-3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(Cc3ccc(F)c(F)c3)nc21 |
| InChI | InChI=1S/C13H10F2N4O2/c1-19-11-10(12(20)18-13(19)21)16-9(17-11)5-6-2-3-7(14)8(15)4-6/h2-4H,5H2,1H3,(H,16,17)(H,18,20,21) |
| InChIKey | XXRHXLRKHCKPTQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |