C13H11FN4O3 — CID 115765308
8-(4-fluoro-3-methoxyphenyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 115765308) has the molecular formula C13H11FN4O3 and a molecular weight of 290.25 g/mol. Its IUPAC name is 8-(4-fluoro-3-methoxyphenyl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(4-fluoro-3-methoxyphenyl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115765308 |
| Molecular Formula | C13H11FN4O3 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 8-(4-fluoro-3-methoxyphenyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | COc1cc(-c2nc3c([nH]2)c(=O)[nH]c(=O)n3C)ccc1F |
| InChI | InChI=1S/C13H11FN4O3/c1-18-11-9(12(19)17-13(18)20)15-10(16-11)6-3-4-7(14)8(5-6)21-2/h3-5H,1-2H3,(H,15,16)(H,17,19,20) |
| InChIKey | KTHPKUMDJIYOFW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |