C13H13FN2O2 — CID 136938664
2-(4-fluoro-3-methoxyphenyl)-4,5-dimethyl-1H-pyrimidin-6-one (PubChem CID 136938664) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-(4-fluoro-3-methoxyphenyl)-4,5-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 2-(4-fluoro-3-methoxyphenyl)-4,5-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136938664 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-(4-fluoro-3-methoxyphenyl)-4,5-dimethyl-1H-pyrimidin-6-one |
| SMILES | COc1cc(-c2nc(C)c(C)c(=O)[nH]2)ccc1F |
| InChI | InChI=1S/C13H13FN2O2/c1-7-8(2)15-12(16-13(7)17)9-4-5-10(14)11(6-9)18-3/h4-6H,1-3H3,(H,15,16,17) |
| InChIKey | PCGAOPLNVVFUKB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |