C13H11F3N2O — CID 135966488
4,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one (PubChem CID 135966488) has the molecular formula C13H11F3N2O and a molecular weight of 268.24 g/mol. Its IUPAC name is 4,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one.
| Compound Name | 4,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135966488 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)[nH]c(=O)c1C |
| InChI | InChI=1S/C13H11F3N2O/c1-7-8(2)17-11(18-12(7)19)9-3-5-10(6-4-9)13(14,15)16/h3-6H,1-2H3,(H,17,18,19) |
| InChIKey | ATBLYBPJWCJGHN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |