C25H26F3N3O — CID 137099715
7-(1-adamantylimino)-6-methyl-2-[4-(trifluoromethyl)phenyl]-5,6-dihydro-3H-cyclopenta[d]pyrimidin-4-one (PubChem CID 137099715) has the molecular formula C25H26F3N3O and a molecular weight of 441.50 g/mol. Its IUPAC name is 7-(1-adamantylimino)-6-methyl-2-[4-(trifluoromethyl)phenyl]-5,6-dihydro-3H-cyclopenta[d]pyrimidin-4-one.
| Compound Name | 7-(1-adamantylimino)-6-methyl-2-[4-(trifluoromethyl)phenyl]-5,6-dihydro-3H-cyclopenta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137099715 |
| Molecular Formula | C25H26F3N3O |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 7-(1-adamantylimino)-6-methyl-2-[4-(trifluoromethyl)phenyl]-5,6-dihydro-3H-cyclopenta[d]pyrimidin-4-one |
| SMILES | CC1Cc2c(nc(-c3ccc(C(F)(F)F)cc3)[nH]c2=O)/C1=N/C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H26F3N3O/c1-13-6-19-21(20(13)31-24-10-14-7-15(11-24)9-16(8-14)12-24)29-22(30-23(19)32)17-2-4-18(5-3-17)25(26,27)28/h2-5,13-16H,6-12H2,1H3,(H,29,30,32)/b31-20+ |
| InChIKey | YOHQYCISFGBRQF-AJBULDERSA-N |
| XLogP | 5.41 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|