C24H28F3N5O — CID 135862126
6-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135862126) has the molecular formula C24H28F3N5O and a molecular weight of 459.52 g/mol. Its IUPAC name is 6-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135862126 |
| Molecular Formula | C24H28F3N5O |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 6-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1CN1CCc2nc(-c3ccc(C(F)(F)F)cc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C24H28F3N5O/c1-14-18(15(2)32(30-14)23(3,4)5)12-31-11-10-20-19(13-31)22(33)29-21(28-20)16-6-8-17(9-7-16)24(25,26)27/h6-9H,10-13H2,1-5H3,(H,28,29,33) |
| InChIKey | PTBUOZKXVCAXGI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |