C21H15F6N3O — CID 135916522
2-[4-(trifluoromethyl)phenyl]-6-[(2,3,4-trifluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135916522) has the molecular formula C21H15F6N3O and a molecular weight of 439.36 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-6-[(2,3,4-trifluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-6-[(2,3,4-trifluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135916522 |
| Molecular Formula | C21H15F6N3O |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-6-[(2,3,4-trifluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(C(F)(F)F)cc2)nc2c1CN(Cc1ccc(F)c(F)c1F)CC2 |
| InChI | InChI=1S/C21H15F6N3O/c22-15-6-3-12(17(23)18(15)24)9-30-8-7-16-14(10-30)20(31)29-19(28-16)11-1-4-13(5-2-11)21(25,26)27/h1-6H,7-10H2,(H,28,29,31) |
| InChIKey | YOCVHCRCHXGYPO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|