C24H18ClF3N4OS — CID 135947329
2-(4-chlorophenyl)-6-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135947329) has the molecular formula C24H18ClF3N4OS and a molecular weight of 502.95 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-6-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135947329 |
| Molecular Formula | C24H18ClF3N4OS |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 2-(4-chlorophenyl)-6-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)nc2c1CN(Cc1csc(-c3ccc(C(F)(F)F)cc3)n1)CC2 |
| InChI | InChI=1S/C24H18ClF3N4OS/c25-17-7-3-14(4-8-17)21-30-20-9-10-32(12-19(20)22(33)31-21)11-18-13-34-23(29-18)15-1-5-16(6-2-15)24(26,27)28/h1-8,13H,9-12H2,(H,30,31,33) |
| InChIKey | UYUWQLCFOQDYMY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |