C21H16F3N5O5 — CID 135917082
6-[(2,4-dinitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135917082) has the molecular formula C21H16F3N5O5 and a molecular weight of 475.38 g/mol. Its IUPAC name is 6-[(2,4-dinitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2,4-dinitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135917082 |
| Molecular Formula | C21H16F3N5O5 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 6-[(2,4-dinitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(C(F)(F)F)cc2)nc2c1CN(Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C21H16F3N5O5/c22-21(23,24)14-4-1-12(2-5-14)19-25-17-7-8-27(11-16(17)20(30)26-19)10-13-3-6-15(28(31)32)9-18(13)29(33)34/h1-6,9H,7-8,10-11H2,(H,25,26,30) |
| InChIKey | IIHSRKUYXJOJFQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|