C21H16Cl2F3N3O — CID 135863799
7-[(2,5-dichlorophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863799) has the molecular formula C21H16Cl2F3N3O and a molecular weight of 454.28 g/mol. Its IUPAC name is 7-[(2,5-dichlorophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,5-dichlorophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863799 |
| Molecular Formula | C21H16Cl2F3N3O |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 7-[(2,5-dichlorophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(C(F)(F)F)cc2)nc2c1CCN(Cc1cc(Cl)ccc1Cl)C2 |
| InChI | InChI=1S/C21H16Cl2F3N3O/c22-15-5-6-17(23)13(9-15)10-29-8-7-16-18(11-29)27-19(28-20(16)30)12-1-3-14(4-2-12)21(24,25)26/h1-6,9H,7-8,10-11H2,(H,27,28,30) |
| InChIKey | WWSVSOQRBOCGJA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |