C20H15Cl2F2N3O — CID 135864141
7-[(2-chloro-3,6-difluorophenyl)methyl]-2-(4-chlorophenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135864141) has the molecular formula C20H15Cl2F2N3O and a molecular weight of 422.26 g/mol. Its IUPAC name is 7-[(2-chloro-3,6-difluorophenyl)methyl]-2-(4-chlorophenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2-chloro-3,6-difluorophenyl)methyl]-2-(4-chlorophenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135864141 |
| Molecular Formula | C20H15Cl2F2N3O |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 7-[(2-chloro-3,6-difluorophenyl)methyl]-2-(4-chlorophenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)nc2c1CCN(Cc1c(F)ccc(F)c1Cl)C2 |
| InChI | InChI=1S/C20H15Cl2F2N3O/c21-12-3-1-11(2-4-12)19-25-17-10-27(8-7-13(17)20(28)26-19)9-14-15(23)5-6-16(24)18(14)22/h1-6H,7-10H2,(H,25,26,28) |
| InChIKey | CSKAODLZAVENMI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|