C21H18F3N3O — CID 135864951
2-(4-methylphenyl)-7-[(3,4,5-trifluorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135864951) has the molecular formula C21H18F3N3O and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-(4-methylphenyl)-7-[(3,4,5-trifluorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(4-methylphenyl)-7-[(3,4,5-trifluorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135864951 |
| Molecular Formula | C21H18F3N3O |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-(4-methylphenyl)-7-[(3,4,5-trifluorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2nc3c(c(=O)[nH]2)CCN(Cc2cc(F)c(F)c(F)c2)C3)cc1 |
| InChI | InChI=1S/C21H18F3N3O/c1-12-2-4-14(5-3-12)20-25-18-11-27(7-6-15(18)21(28)26-20)10-13-8-16(22)19(24)17(23)9-13/h2-5,8-9H,6-7,10-11H2,1H3,(H,25,26,28) |
| InChIKey | ROZTXKKRYFRXOC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|