C21H22N4O — CID 135863928
7-[(2,5-dimethylphenyl)methyl]-2-pyridin-4-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863928) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 7-[(2,5-dimethylphenyl)methyl]-2-pyridin-4-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,5-dimethylphenyl)methyl]-2-pyridin-4-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863928 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 7-[(2,5-dimethylphenyl)methyl]-2-pyridin-4-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1ccc(C)c(CN2CCc3c(nc(-c4ccncc4)[nH]c3=O)C2)c1 |
| InChI | InChI=1S/C21H22N4O/c1-14-3-4-15(2)17(11-14)12-25-10-7-18-19(13-25)23-20(24-21(18)26)16-5-8-22-9-6-16/h3-6,8-9,11H,7,10,12-13H2,1-2H3,(H,23,24,26) |
| InChIKey | NCHIWRIHMBVFIN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |