C18H22F3N3 — CID 138510043
4-methyl-1-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1H-imidazol-4-yl]methyl]piperidine (PubChem CID 138510043) has the molecular formula C18H22F3N3 and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-methyl-1-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1H-imidazol-4-yl]methyl]piperidine.
| Compound Name | 4-methyl-1-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1H-imidazol-4-yl]methyl]piperidine |
|---|---|
| PubChem CID | 138510043 |
| Molecular Formula | C18H22F3N3 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-methyl-1-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1H-imidazol-4-yl]methyl]piperidine |
| SMILES | Cc1[nH]c(-c2ccc(C(F)(F)F)cc2)nc1CN1CCC(C)CC1 |
| InChI | InChI=1S/C18H22F3N3/c1-12-7-9-24(10-8-12)11-16-13(2)22-17(23-16)14-3-5-15(6-4-14)18(19,20)21/h3-6,12H,7-11H2,1-2H3,(H,22,23) |
| InChIKey | YFEWKJBRKRZITC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |