C36H45F3N4O — CID 142173124
ethylbenzene;4-methyl-1-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1H-imidazol-4-yl]methyl]piperidine;N-[(2E,4Z)-octa-2,4-dien-6-yn-2-yl]acetamide (PubChem CID 142173124) has the molecular formula C36H45F3N4O and a molecular weight of 606.78 g/mol. Its IUPAC name is ethylbenzene;4-methyl-1-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1H-imidazol-4-yl]methyl]piperidine;N-[(2E,4Z)-octa-2,4-dien-6-yn-2-yl]acetamide.
| Compound Name | ethylbenzene;4-methyl-1-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1H-imidazol-4-yl]methyl]piperidine;N-[(2E,4Z)-octa-2,4-dien-6-yn-2-yl]acetamide |
|---|---|
| PubChem CID | 142173124 |
| Molecular Formula | C36H45F3N4O |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.35 |
| IUPAC Name | ethylbenzene;4-methyl-1-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1H-imidazol-4-yl]methyl]piperidine;N-[(2E,4Z)-octa-2,4-dien-6-yn-2-yl]acetamide |
| SMILES | CC#C/C=C\C=C(/C)NC(C)=O.CCc1ccccc1.Cc1[nH]c(-c2ccc(C(F)(F)F)cc2)nc1CN1CCC(C)CC1 |
| InChI | InChI=1S/C18H22F3N3.C10H13NO.C8H10/c1-12-7-9-24(10-8-12)11-16-13(2)22-17(23-16)14-3-5-15(6-4-14)18(19,20)21;1-4-5-6-7-8-9(2)11-10(3)12;1-2-8-6-4-3-5-7-8/h3-6,12H,7-11H2,1-2H3,(H,22,23);6-8H,1-3H3,(H,11,12);3-7H,2H2,1H3/b;7-6-,9-8+; |
| InChIKey | HJGOIEQLVSZFDS-SIVGEBMOSA-N |
| XLogP | 8.49 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|