C11H8ClFN2O — CID 136740674
5-chloro-2-(4-fluorophenyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 136740674) has the molecular formula C11H8ClFN2O and a molecular weight of 238.65 g/mol. Its IUPAC name is 5-chloro-2-(4-fluorophenyl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-(4-fluorophenyl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136740674 |
| Molecular Formula | C11H8ClFN2O |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 5-chloro-2-(4-fluorophenyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2ccc(F)cc2)[nH]c(=O)c1Cl |
| InChI | InChI=1S/C11H8ClFN2O/c1-6-9(12)11(16)15-10(14-6)7-2-4-8(13)5-3-7/h2-5H,1H3,(H,14,15,16) |
| InChIKey | ZHZRUYJTNCLDJK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |