C5H6ClN3O — CID 135905258
2-amino-5-chloro-4-methyl-1H-pyrimidin-6-one (PubChem CID 135905258) has the molecular formula C5H6ClN3O and a molecular weight of 159.58 g/mol. Its IUPAC name is 2-amino-5-chloro-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-amino-5-chloro-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135905258 |
| Molecular Formula | C5H6ClN3O |
| Molecular Weight | 159.58 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 2-amino-5-chloro-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N)[nH]c(=O)c1Cl |
| InChI | InChI=1S/C5H6ClN3O/c1-2-3(6)4(10)9-5(7)8-2/h1H3,(H3,7,8,9,10) |
| InChIKey | ONGTVDNWEWISGD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.58 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |