C6H8N4O2 — CID 166684084
N-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)formamide (PubChem CID 166684084) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is N-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)formamide.
| Compound Name | N-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)formamide |
|---|---|
| PubChem CID | 166684084 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | N-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)formamide |
| SMILES | Cc1nc(N)[nH]c(=O)c1NC=O |
| InChI | InChI=1S/C6H8N4O2/c1-3-4(8-2-11)5(12)10-6(7)9-3/h2H,1H3,(H,8,11)(H3,7,9,10,12) |
| InChIKey | OUAVSNRXCHIBGO-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|