C7H10BrN3O — CID 135442066
2-amino-5-(2-bromoethyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 135442066) has the molecular formula C7H10BrN3O and a molecular weight of 232.08 g/mol. Its IUPAC name is 2-amino-5-(2-bromoethyl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-amino-5-(2-bromoethyl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135442066 |
| Molecular Formula | C7H10BrN3O |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 2-amino-5-(2-bromoethyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N)[nH]c(=O)c1CCBr |
| InChI | InChI=1S/C7H10BrN3O/c1-4-5(2-3-8)6(12)11-7(9)10-4/h2-3H2,1H3,(H3,9,10,11,12) |
| InChIKey | UBRVUFNJVNUYMC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|