C9H16N4O — CID 135493668
2,4-diamino-5-(3-methylbutyl)-1H-pyrimidin-6-one (PubChem CID 135493668) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,4-diamino-5-(3-methylbutyl)-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-(3-methylbutyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135493668 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2,4-diamino-5-(3-methylbutyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)CCc1c(N)nc(N)[nH]c1=O |
| InChI | InChI=1S/C9H16N4O/c1-5(2)3-4-6-7(10)12-9(11)13-8(6)14/h5H,3-4H2,1-2H3,(H5,10,11,12,13,14) |
| InChIKey | NXNZQDMDARVZET-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |