C10H15N3O5 — CID 118369795
ethyl (2S)-4-(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)-2-hydroxybutanoate (PubChem CID 118369795) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is ethyl (2S)-4-(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)-2-hydroxybutanoate.
| Compound Name | ethyl (2S)-4-(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)-2-hydroxybutanoate |
|---|---|
| PubChem CID | 118369795 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | ethyl (2S)-4-(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)-2-hydroxybutanoate |
| SMILES | CCOC(=O)[C@@H](O)CCc1c(O)nc(N)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O5/c1-2-18-9(17)6(14)4-3-5-7(15)12-10(11)13-8(5)16/h6,14H,2-4H2,1H3,(H4,11,12,13,15,16)/t6-/m0/s1 |
| InChIKey | UGLAYIAUAXAHSB-LURJTMIESA-N |
| XLogP | -1.09 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |